C18H17F2NO4S — CID 2564278
1-(3,4-difluorophenyl)sulfonyl-4-phenylpiperidine-4-carboxylic acid (PubChem CID 2564278) has the molecular formula C18H17F2NO4S and a molecular weight of 381.40 g/mol. Its IUPAC name is 1-(3,4-difluorophenyl)sulfonyl-4-phenylpiperidine-4-carboxylic acid.
| Compound Name | 1-(3,4-difluorophenyl)sulfonyl-4-phenylpiperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 2564278 |
| Molecular Formula | C18H17F2NO4S |
| Molecular Weight | 381.40 g/mol |
| Exact Mass | 381.08 |
| IUPAC Name | 1-(3,4-difluorophenyl)sulfonyl-4-phenylpiperidine-4-carboxylic acid |
| SMILES | O=C(O)C1(c2ccccc2)CCN(S(=O)(=O)c2ccc(F)c(F)c2)CC1 |
| InChI | InChI=1S/C18H17F2NO4S/c19-15-7-6-14(12-16(15)20)26(24,25)21-10-8-18(9-11-21,17(22)23)13-4-2-1-3-5-13/h1-7,12H,8-11H2,(H,22,23) |
| InChIKey | KMCJCHZAMGFUNL-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.40 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |