C18H18ClNO4S — CID 1242607
1-(4-chlorophenyl)sulfonyl-4-phenylpiperidine-4-carboxylic acid (PubChem CID 1242607) has the molecular formula C18H18ClNO4S and a molecular weight of 379.87 g/mol. Its IUPAC name is 1-(4-chlorophenyl)sulfonyl-4-phenylpiperidine-4-carboxylic acid.
| Compound Name | 1-(4-chlorophenyl)sulfonyl-4-phenylpiperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 1242607 |
| Molecular Formula | C18H18ClNO4S |
| Molecular Weight | 379.87 g/mol |
| Exact Mass | 379.06 |
| IUPAC Name | 1-(4-chlorophenyl)sulfonyl-4-phenylpiperidine-4-carboxylic acid |
| SMILES | O=C(O)C1(c2ccccc2)CCN(S(=O)(=O)c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C18H18ClNO4S/c19-15-6-8-16(9-7-15)25(23,24)20-12-10-18(11-13-20,17(21)22)14-4-2-1-3-5-14/h1-9H,10-13H2,(H,21,22) |
| InChIKey | RUKVZKQCIHJKQR-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.87 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |