C20H26F3N3O2 — CID 57395870
6-[4-(3-piperidin-1-ylpropoxy)phenyl]-2-(2,2,2-trifluoroethyl)-4,5-dihydropyridazin-3-one (PubChem CID 57395870) has the molecular formula C20H26F3N3O2 and a molecular weight of 397.44 g/mol. Its IUPAC name is 6-[4-(3-piperidin-1-ylpropoxy)phenyl]-2-(2,2,2-trifluoroethyl)-4,5-dihydropyridazin-3-one.
| Compound Name | 6-[4-(3-piperidin-1-ylpropoxy)phenyl]-2-(2,2,2-trifluoroethyl)-4,5-dihydropyridazin-3-one |
|---|---|
| PubChem CID | 57395870 |
| Molecular Formula | C20H26F3N3O2 |
| Molecular Weight | 397.44 g/mol |
| Exact Mass | 397.20 |
| IUPAC Name | 6-[4-(3-piperidin-1-ylpropoxy)phenyl]-2-(2,2,2-trifluoroethyl)-4,5-dihydropyridazin-3-one |
| SMILES | O=C1CCC(c2ccc(OCCCN3CCCCC3)cc2)=NN1CC(F)(F)F |
| InChI | InChI=1S/C20H26F3N3O2/c21-20(22,23)15-26-19(27)10-9-18(24-26)16-5-7-17(8-6-16)28-14-4-13-25-11-2-1-3-12-25/h5-8H,1-4,9-15H2 |
| InChIKey | YBCATEZOXUMASY-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 45.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.44 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|