C20H20N6O2 — CID 57396034
3-(oxan-4-ylmethyl)-5-(4-pyrazol-1-ylphenyl)-1H-imidazo[4,5-b]pyrazin-2-one (PubChem CID 57396034) has the molecular formula C20H20N6O2 and a molecular weight of 376.42 g/mol. Its IUPAC name is 3-(oxan-4-ylmethyl)-5-(4-pyrazol-1-ylphenyl)-1H-imidazo[4,5-b]pyrazin-2-one.
| Compound Name | 3-(oxan-4-ylmethyl)-5-(4-pyrazol-1-ylphenyl)-1H-imidazo[4,5-b]pyrazin-2-one |
|---|---|
| PubChem CID | 57396034 |
| Molecular Formula | C20H20N6O2 |
| Molecular Weight | 376.42 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | 3-(oxan-4-ylmethyl)-5-(4-pyrazol-1-ylphenyl)-1H-imidazo[4,5-b]pyrazin-2-one |
| SMILES | O=c1[nH]c2ncc(-c3ccc(-n4cccn4)cc3)nc2n1CC1CCOCC1 |
| InChI | InChI=1S/C20H20N6O2/c27-20-24-18-19(25(20)13-14-6-10-28-11-7-14)23-17(12-21-18)15-2-4-16(5-3-15)26-9-1-8-22-26/h1-5,8-9,12,14H,6-7,10-11,13H2,(H,21,24,27) |
| InChIKey | UYHJRNVVRSAPDJ-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 90.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.42 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |