C16H17N5O5S — CID 57397866
4-amino-7-[(2S,3S,4S,5S)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-thiophen-2-ylpyrrolo[2,3-d]pyrimidine-5-carboxamide (PubChem CID 57397866) has the molecular formula C16H17N5O5S and a molecular weight of 391.41 g/mol. Its IUPAC name is 4-amino-7-[(2S,3S,4S,5S)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-thiophen-2-ylpyrrolo[2,3-d]pyrimidine-5-carboxamide.
| Compound Name | 4-amino-7-[(2S,3S,4S,5S)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-thiophen-2-ylpyrrolo[2,3-d]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 57397866 |
| Molecular Formula | C16H17N5O5S |
| Molecular Weight | 391.41 g/mol |
| Exact Mass | 391.10 |
| IUPAC Name | 4-amino-7-[(2S,3S,4S,5S)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-thiophen-2-ylpyrrolo[2,3-d]pyrimidine-5-carboxamide |
| SMILES | NC(=O)c1c(-c2cccs2)n([C@H]2O[C@@H](CO)[C@@H](O)[C@@H]2O)c2ncnc(N)c12 |
| InChI | InChI=1S/C16H17N5O5S/c17-13-9-8(14(18)25)10(7-2-1-3-27-7)21(15(9)20-5-19-13)16-12(24)11(23)6(4-22)26-16/h1-3,5-6,11-12,16,22-24H,4H2,(H2,18,25)(H2,17,19,20)/t6-,11+,12-,16-/m0/s1 |
| InChIKey | FJGSHLIEDFJZKC-NIVLEXSMSA-N |
| XLogP | -0.55 |
| TPSA | 169.74 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.41 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |