C16H15N5O4S — CID 57397914
4-amino-7-[(2S,3S,4S,5S)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-thiophen-2-ylpyrrolo[2,3-d]pyrimidine-5-carbonitrile (PubChem CID 57397914) has the molecular formula C16H15N5O4S and a molecular weight of 373.39 g/mol. Its IUPAC name is 4-amino-7-[(2S,3S,4S,5S)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-thiophen-2-ylpyrrolo[2,3-d]pyrimidine-5-carbonitrile.
| Compound Name | 4-amino-7-[(2S,3S,4S,5S)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-thiophen-2-ylpyrrolo[2,3-d]pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 57397914 |
| Molecular Formula | C16H15N5O4S |
| Molecular Weight | 373.39 g/mol |
| Exact Mass | 373.08 |
| IUPAC Name | 4-amino-7-[(2S,3S,4S,5S)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-thiophen-2-ylpyrrolo[2,3-d]pyrimidine-5-carbonitrile |
| SMILES | N#Cc1c(-c2cccs2)n([C@H]2O[C@@H](CO)[C@@H](O)[C@@H]2O)c2ncnc(N)c12 |
| InChI | InChI=1S/C16H15N5O4S/c17-4-7-10-14(18)19-6-20-15(10)21(11(7)9-2-1-3-26-9)16-13(24)12(23)8(5-22)25-16/h1-3,6,8,12-13,16,22-24H,5H2,(H2,18,19,20)/t8-,12+,13-,16-/m0/s1 |
| InChIKey | LICJTUNARIJHIA-IHSDMGMISA-N |
| XLogP | 0.23 |
| TPSA | 150.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.39 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |