C20H14ClN5O — CID 57399418
1-[(2-amino-4-pyridinyl)methyl]-5-chloro-3-(2-oxo-1H-pyridin-3-yl)indole-2-carbonitrile (PubChem CID 57399418) has the molecular formula C20H14ClN5O and a molecular weight of 375.82 g/mol. Its IUPAC name is 1-[(2-amino-4-pyridinyl)methyl]-5-chloro-3-(2-oxo-1H-pyridin-3-yl)indole-2-carbonitrile.
| Compound Name | 1-[(2-amino-4-pyridinyl)methyl]-5-chloro-3-(2-oxo-1H-pyridin-3-yl)indole-2-carbonitrile |
|---|---|
| PubChem CID | 57399418 |
| Molecular Formula | C20H14ClN5O |
| Molecular Weight | 375.82 g/mol |
| Exact Mass | 375.09 |
| IUPAC Name | 1-[(2-amino-4-pyridinyl)methyl]-5-chloro-3-(2-oxo-1H-pyridin-3-yl)indole-2-carbonitrile |
| SMILES | N#Cc1c(-c2ccc[nH]c2=O)c2cc(Cl)ccc2n1Cc1ccnc(N)c1 |
| InChI | InChI=1S/C20H14ClN5O/c21-13-3-4-16-15(9-13)19(14-2-1-6-25-20(14)27)17(10-22)26(16)11-12-5-7-24-18(23)8-12/h1-9H,11H2,(H2,23,24)(H,25,27) |
| InChIKey | NGKZTDNOHWUZSL-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 100.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.82 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |