C21H21Cl2N3 — CID 162124171
5-chloro-3-(2-chlorophenyl)-1-[2-(diethylamino)ethyl]indole-2-carbonitrile (PubChem CID 162124171) has the molecular formula C21H21Cl2N3 and a molecular weight of 386.33 g/mol. Its IUPAC name is 5-chloro-3-(2-chlorophenyl)-1-[2-(diethylamino)ethyl]indole-2-carbonitrile.
| Compound Name | 5-chloro-3-(2-chlorophenyl)-1-[2-(diethylamino)ethyl]indole-2-carbonitrile |
|---|---|
| PubChem CID | 162124171 |
| Molecular Formula | C21H21Cl2N3 |
| Molecular Weight | 386.33 g/mol |
| Exact Mass | 385.11 |
| IUPAC Name | 5-chloro-3-(2-chlorophenyl)-1-[2-(diethylamino)ethyl]indole-2-carbonitrile |
| SMILES | CCN(CC)CCn1c(C#N)c(-c2ccccc2Cl)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C21H21Cl2N3/c1-3-25(4-2)11-12-26-19-10-9-15(22)13-17(19)21(20(26)14-24)16-7-5-6-8-18(16)23/h5-10,13H,3-4,11-12H2,1-2H3 |
| InChIKey | ZHUORVXRFCLAOM-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 31.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.33 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |