C22H26ClNO — CID 56608954
3-(2-chlorophenyl)-2-methyl-5-[(2-methylpropan-2-yl)oxy]-1-propylindole (PubChem CID 56608954) has the molecular formula C22H26ClNO and a molecular weight of 355.91 g/mol. Its IUPAC name is 3-(2-chlorophenyl)-2-methyl-5-[(2-methylpropan-2-yl)oxy]-1-propylindole.
| Compound Name | 3-(2-chlorophenyl)-2-methyl-5-[(2-methylpropan-2-yl)oxy]-1-propylindole |
|---|---|
| PubChem CID | 56608954 |
| Molecular Formula | C22H26ClNO |
| Molecular Weight | 355.91 g/mol |
| Exact Mass | 355.17 |
| IUPAC Name | 3-(2-chlorophenyl)-2-methyl-5-[(2-methylpropan-2-yl)oxy]-1-propylindole |
| SMILES | CCCn1c(C)c(-c2ccccc2Cl)c2cc(OC(C)(C)C)ccc21 |
| InChI | InChI=1S/C22H26ClNO/c1-6-13-24-15(2)21(17-9-7-8-10-19(17)23)18-14-16(11-12-20(18)24)25-22(3,4)5/h7-12,14H,6,13H2,1-5H3 |
| InChIKey | UJNPYGXYFNGOPI-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 14.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.91 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |