C24H31NO — CID 56611670
2-methyl-5-[(2-methylpropan-2-yl)oxy]-3-(2-phenylethyl)-1-propylindole (PubChem CID 56611670) has the molecular formula C24H31NO and a molecular weight of 349.52 g/mol. Its IUPAC name is 2-methyl-5-[(2-methylpropan-2-yl)oxy]-3-(2-phenylethyl)-1-propylindole.
| Compound Name | 2-methyl-5-[(2-methylpropan-2-yl)oxy]-3-(2-phenylethyl)-1-propylindole |
|---|---|
| PubChem CID | 56611670 |
| Molecular Formula | C24H31NO |
| Molecular Weight | 349.52 g/mol |
| Exact Mass | 349.24 |
| IUPAC Name | 2-methyl-5-[(2-methylpropan-2-yl)oxy]-3-(2-phenylethyl)-1-propylindole |
| SMILES | CCCn1c(C)c(CCc2ccccc2)c2cc(OC(C)(C)C)ccc21 |
| InChI | InChI=1S/C24H31NO/c1-6-16-25-18(2)21(14-12-19-10-8-7-9-11-19)22-17-20(13-15-23(22)25)26-24(3,4)5/h7-11,13,15,17H,6,12,14,16H2,1-5H3 |
| InChIKey | FIRDOKVAROXHDC-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 14.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.52 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|