C22H28N2O — CID 56624723
4-[3-methyl-5-[(2-methylpropan-2-yl)oxy]-1-propylindol-2-yl]aniline (PubChem CID 56624723) has the molecular formula C22H28N2O and a molecular weight of 336.48 g/mol. Its IUPAC name is 4-[3-methyl-5-[(2-methylpropan-2-yl)oxy]-1-propylindol-2-yl]aniline.
| Compound Name | 4-[3-methyl-5-[(2-methylpropan-2-yl)oxy]-1-propylindol-2-yl]aniline |
|---|---|
| PubChem CID | 56624723 |
| Molecular Formula | C22H28N2O |
| Molecular Weight | 336.48 g/mol |
| Exact Mass | 336.22 |
| IUPAC Name | 4-[3-methyl-5-[(2-methylpropan-2-yl)oxy]-1-propylindol-2-yl]aniline |
| SMILES | CCCn1c(-c2ccc(N)cc2)c(C)c2cc(OC(C)(C)C)ccc21 |
| InChI | InChI=1S/C22H28N2O/c1-6-13-24-20-12-11-18(25-22(3,4)5)14-19(20)15(2)21(24)16-7-9-17(23)10-8-16/h7-12,14H,6,13,23H2,1-5H3 |
| InChIKey | DRHRRHULFGLVRW-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 40.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.48 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|