C14H19N5 — CID 57399967
3-(octylamino)pyrazine-2,5-dicarbonitrile (PubChem CID 57399967) has the molecular formula C14H19N5 and a molecular weight of 257.34 g/mol. Its IUPAC name is 3-(octylamino)pyrazine-2,5-dicarbonitrile.
| Compound Name | 3-(octylamino)pyrazine-2,5-dicarbonitrile |
|---|---|
| PubChem CID | 57399967 |
| Molecular Formula | C14H19N5 |
| Molecular Weight | 257.34 g/mol |
| Exact Mass | 257.16 |
| IUPAC Name | 3-(octylamino)pyrazine-2,5-dicarbonitrile |
| SMILES | CCCCCCCCNc1nc(C#N)cnc1C#N |
| InChI | InChI=1S/C14H19N5/c1-2-3-4-5-6-7-8-17-14-13(10-16)18-11-12(9-15)19-14/h11H,2-8H2,1H3,(H,17,19) |
| InChIKey | BRSVMMUKGMVYNR-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 85.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.34 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|