C35H30N4O2 — CID 57401827
5-(4-cyanophenyl)-N-[(4-phenylphenyl)methyl]-N-(4-piperazin-1-ylphenyl)furan-2-carboxamide (PubChem CID 57401827) has the molecular formula C35H30N4O2 and a molecular weight of 538.65 g/mol. Its IUPAC name is 5-(4-cyanophenyl)-N-[(4-phenylphenyl)methyl]-N-(4-piperazin-1-ylphenyl)furan-2-carboxamide.
| Compound Name | 5-(4-cyanophenyl)-N-[(4-phenylphenyl)methyl]-N-(4-piperazin-1-ylphenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 57401827 |
| Molecular Formula | C35H30N4O2 |
| Molecular Weight | 538.65 g/mol |
| Exact Mass | 538.24 |
| IUPAC Name | 5-(4-cyanophenyl)-N-[(4-phenylphenyl)methyl]-N-(4-piperazin-1-ylphenyl)furan-2-carboxamide |
| SMILES | N#Cc1ccc(-c2ccc(C(=O)N(Cc3ccc(-c4ccccc4)cc3)c3ccc(N4CCNCC4)cc3)o2)cc1 |
| InChI | InChI=1S/C35H30N4O2/c36-24-26-6-12-30(13-7-26)33-18-19-34(41-33)35(40)39(32-16-14-31(15-17-32)38-22-20-37-21-23-38)25-27-8-10-29(11-9-27)28-4-2-1-3-5-28/h1-19,37H,20-23,25H2 |
| InChIKey | CNORLXHSUGTBGL-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 72.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.65 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|