C28H31ClFN3O5 — CID 57402524
3-(4-fluorophenyl)-1-[2-[2-hydroxy-3-[4-(4-nitrophenyl)piperazin-1-yl]propoxy]phenyl]propan-1-one;hydrochloride (PubChem CID 57402524) has the molecular formula C28H31ClFN3O5 and a molecular weight of 544.02 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-1-[2-[2-hydroxy-3-[4-(4-nitrophenyl)piperazin-1-yl]propoxy]phenyl]propan-1-one;hydrochloride.
| Compound Name | 3-(4-fluorophenyl)-1-[2-[2-hydroxy-3-[4-(4-nitrophenyl)piperazin-1-yl]propoxy]phenyl]propan-1-one;hydrochloride |
|---|---|
| PubChem CID | 57402524 |
| Molecular Formula | C28H31ClFN3O5 |
| Molecular Weight | 544.02 g/mol |
| Exact Mass | 543.19 |
| IUPAC Name | 3-(4-fluorophenyl)-1-[2-[2-hydroxy-3-[4-(4-nitrophenyl)piperazin-1-yl]propoxy]phenyl]propan-1-one;hydrochloride |
| SMILES | Cl.O=C(CCc1ccc(F)cc1)c1ccccc1OCC(O)CN1CCN(c2ccc([N+](=O)[O-])cc2)CC1 |
| InChI | InChI=1S/C28H30FN3O5.ClH/c29-22-8-5-21(6-9-22)7-14-27(34)26-3-1-2-4-28(26)37-20-25(33)19-30-15-17-31(18-16-30)23-10-12-24(13-11-23)32(35)36;/h1-6,8-13,25,33H,7,14-20H2;1H |
| InChIKey | QEQSGTNUEQJXEU-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 96.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.02 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|