C28H30ClF2N3O5 — CID 57400835
1-[5-fluoro-2-[2-hydroxy-3-[4-(4-nitrophenyl)piperazin-1-yl]propoxy]phenyl]-3-(4-fluorophenyl)propan-1-one;hydrochloride (PubChem CID 57400835) has the molecular formula C28H30ClF2N3O5 and a molecular weight of 562.01 g/mol. Its IUPAC name is 1-[5-fluoro-2-[2-hydroxy-3-[4-(4-nitrophenyl)piperazin-1-yl]propoxy]phenyl]-3-(4-fluorophenyl)propan-1-one;hydrochloride.
| Compound Name | 1-[5-fluoro-2-[2-hydroxy-3-[4-(4-nitrophenyl)piperazin-1-yl]propoxy]phenyl]-3-(4-fluorophenyl)propan-1-one;hydrochloride |
|---|---|
| PubChem CID | 57400835 |
| Molecular Formula | C28H30ClF2N3O5 |
| Molecular Weight | 562.01 g/mol |
| Exact Mass | 561.18 |
| IUPAC Name | 1-[5-fluoro-2-[2-hydroxy-3-[4-(4-nitrophenyl)piperazin-1-yl]propoxy]phenyl]-3-(4-fluorophenyl)propan-1-one;hydrochloride |
| SMILES | Cl.O=C(CCc1ccc(F)cc1)c1cc(F)ccc1OCC(O)CN1CCN(c2ccc([N+](=O)[O-])cc2)CC1 |
| InChI | InChI=1S/C28H29F2N3O5.ClH/c29-21-4-1-20(2-5-21)3-11-27(35)26-17-22(30)6-12-28(26)38-19-25(34)18-31-13-15-32(16-14-31)23-7-9-24(10-8-23)33(36)37;/h1-2,4-10,12,17,25,34H,3,11,13-16,18-19H2;1H |
| InChIKey | KUAHDURBONKDMS-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 96.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.01 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|