C24H19NO4S — CID 57403084
methyl 4-[4-(naphthalen-2-ylsulfonylamino)phenyl]benzoate (PubChem CID 57403084) has the molecular formula C24H19NO4S and a molecular weight of 417.49 g/mol. Its IUPAC name is methyl 4-[4-(naphthalen-2-ylsulfonylamino)phenyl]benzoate.
| Compound Name | methyl 4-[4-(naphthalen-2-ylsulfonylamino)phenyl]benzoate |
|---|---|
| PubChem CID | 57403084 |
| Molecular Formula | C24H19NO4S |
| Molecular Weight | 417.49 g/mol |
| Exact Mass | 417.10 |
| IUPAC Name | methyl 4-[4-(naphthalen-2-ylsulfonylamino)phenyl]benzoate |
| SMILES | COC(=O)c1ccc(-c2ccc(NS(=O)(=O)c3ccc4ccccc4c3)cc2)cc1 |
| InChI | InChI=1S/C24H19NO4S/c1-29-24(26)20-8-6-18(7-9-20)19-10-13-22(14-11-19)25-30(27,28)23-15-12-17-4-2-3-5-21(17)16-23/h2-16,25H,1H3 |
| InChIKey | PGRBLRWOWOVOLO-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.49 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |