C24H27NO4 — CID 57403213
3,6-dimethyl-2-[[3-(oxan-4-ylmethoxy)phenoxy]methyl]-1H-quinolin-4-one (PubChem CID 57403213) has the molecular formula C24H27NO4 and a molecular weight of 393.48 g/mol. Its IUPAC name is 3,6-dimethyl-2-[[3-(oxan-4-ylmethoxy)phenoxy]methyl]-1H-quinolin-4-one.
| Compound Name | 3,6-dimethyl-2-[[3-(oxan-4-ylmethoxy)phenoxy]methyl]-1H-quinolin-4-one |
|---|---|
| PubChem CID | 57403213 |
| Molecular Formula | C24H27NO4 |
| Molecular Weight | 393.48 g/mol |
| Exact Mass | 393.19 |
| IUPAC Name | 3,6-dimethyl-2-[[3-(oxan-4-ylmethoxy)phenoxy]methyl]-1H-quinolin-4-one |
| SMILES | Cc1ccc2[nH]c(COc3cccc(OCC4CCOCC4)c3)c(C)c(=O)c2c1 |
| InChI | InChI=1S/C24H27NO4/c1-16-6-7-22-21(12-16)24(26)17(2)23(25-22)15-29-20-5-3-4-19(13-20)28-14-18-8-10-27-11-9-18/h3-7,12-13,18H,8-11,14-15H2,1-2H3,(H,25,26) |
| InChIKey | HQSQYWFCWHOSNQ-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 60.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.48 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |