C37H47N7O4S2 — CID 57406030
1,3-thiazol-5-ylmethyl N-[(2R,5R)-5-[[(2S)-1-[methyl-[(2-propan-2-yl-1,3-thiazol-4-yl)methyl]carbamoyl]piperazine-2-carbonyl]amino]-1,6-diphenylhexan-2-yl]carbamate (PubChem CID 57406030) has the molecular formula C37H47N7O4S2 and a molecular weight of 717.96 g/mol. Its IUPAC name is 1,3-thiazol-5-ylmethyl N-[(2R,5R)-5-[[(2S)-1-[methyl-[(2-propan-2-yl-1,3-thiazol-4-yl)methyl]carbamoyl]piperazine-2-carbonyl]amino]-1,6-diphenylhexan-2-yl]carbamate.
| Compound Name | 1,3-thiazol-5-ylmethyl N-[(2R,5R)-5-[[(2S)-1-[methyl-[(2-propan-2-yl-1,3-thiazol-4-yl)methyl]carbamoyl]piperazine-2-carbonyl]amino]-1,6-diphenylhexan-2-yl]carbamate |
|---|---|
| PubChem CID | 57406030 |
| Molecular Formula | C37H47N7O4S2 |
| Molecular Weight | 717.96 g/mol |
| Exact Mass | 717.31 |
| IUPAC Name | 1,3-thiazol-5-ylmethyl N-[(2R,5R)-5-[[(2S)-1-[methyl-[(2-propan-2-yl-1,3-thiazol-4-yl)methyl]carbamoyl]piperazine-2-carbonyl]amino]-1,6-diphenylhexan-2-yl]carbamate |
| SMILES | CC(C)c1nc(CN(C)C(=O)N2CCNC[C@H]2C(=O)N[C@H](CC[C@H](Cc2ccccc2)NC(=O)OCc2cncs2)Cc2ccccc2)cs1 |
| InChI | InChI=1S/C37H47N7O4S2/c1-26(2)35-41-31(24-49-35)22-43(3)37(47)44-17-16-38-21-33(44)34(45)40-29(18-27-10-6-4-7-11-27)14-15-30(19-28-12-8-5-9-13-28)42-36(46)48-23-32-20-39-25-50-32/h4-13,20,24-26,29-30,33,38H,14-19,21-23H2,1-3H3,(H,40,45)(H,42,46)/t29-,30-,33+/m1/s1 |
| InChIKey | MRCSKHRJISTYLE-QSCLJHCWSA-N |
| XLogP | 5.59 |
| TPSA | 128.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 717.96 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |