C36H44N6O5S2 — CID 163473060
1,3-thiazol-5-ylmethyl N-[(2R,5R)-5-[[2-hydroxy-1-[[methyl-[(2-propan-2-yl-1,3-thiazol-4-yl)methyl]carbamoyl]amino]cyclopropanecarbonyl]amino]-1,6-diphenylhexan-2-yl]carbamate (PubChem CID 163473060) has the molecular formula C36H44N6O5S2 and a molecular weight of 704.92 g/mol. Its IUPAC name is 1,3-thiazol-5-ylmethyl N-[(2R,5R)-5-[[2-hydroxy-1-[[methyl-[(2-propan-2-yl-1,3-thiazol-4-yl)methyl]carbamoyl]amino]cyclopropanecarbonyl]amino]-1,6-diphenylhexan-2-yl]carbamate.
| Compound Name | 1,3-thiazol-5-ylmethyl N-[(2R,5R)-5-[[2-hydroxy-1-[[methyl-[(2-propan-2-yl-1,3-thiazol-4-yl)methyl]carbamoyl]amino]cyclopropanecarbonyl]amino]-1,6-diphenylhexan-2-yl]carbamate |
|---|---|
| PubChem CID | 163473060 |
| Molecular Formula | C36H44N6O5S2 |
| Molecular Weight | 704.92 g/mol |
| Exact Mass | 704.28 |
| IUPAC Name | 1,3-thiazol-5-ylmethyl N-[(2R,5R)-5-[[2-hydroxy-1-[[methyl-[(2-propan-2-yl-1,3-thiazol-4-yl)methyl]carbamoyl]amino]cyclopropanecarbonyl]amino]-1,6-diphenylhexan-2-yl]carbamate |
| SMILES | CC(C)c1nc(CN(C)C(=O)NC2(C(=O)N[C@H](CC[C@H](Cc3ccccc3)NC(=O)OCc3cncs3)Cc3ccccc3)CC2O)cs1 |
| InChI | InChI=1S/C36H44N6O5S2/c1-24(2)32-38-29(22-48-32)20-42(3)34(45)41-36(18-31(36)43)33(44)39-27(16-25-10-6-4-7-11-25)14-15-28(17-26-12-8-5-9-13-26)40-35(46)47-21-30-19-37-23-49-30/h4-13,19,22-24,27-28,31,43H,14-18,20-21H2,1-3H3,(H,39,44)(H,40,46)(H,41,45)/t27-,28-,31?,36?/m1/s1 |
| InChIKey | BYEGRDIRHSCKSB-QPIZWMCYSA-N |
| XLogP | 5.41 |
| TPSA | 145.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.92 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |