C21H15N7O4 — CID 57406576
7-methoxy-4-[[6-(4-nitrophenyl)-[1,2,4]triazolo[4,3-b][1,2,4]triazin-3-yl]methoxy]quinoline (PubChem CID 57406576) has the molecular formula C21H15N7O4 and a molecular weight of 429.40 g/mol. Its IUPAC name is 7-methoxy-4-[[6-(4-nitrophenyl)-[1,2,4]triazolo[4,3-b][1,2,4]triazin-3-yl]methoxy]quinoline.
| Compound Name | 7-methoxy-4-[[6-(4-nitrophenyl)-[1,2,4]triazolo[4,3-b][1,2,4]triazin-3-yl]methoxy]quinoline |
|---|---|
| PubChem CID | 57406576 |
| Molecular Formula | C21H15N7O4 |
| Molecular Weight | 429.40 g/mol |
| Exact Mass | 429.12 |
| IUPAC Name | 7-methoxy-4-[[6-(4-nitrophenyl)-[1,2,4]triazolo[4,3-b][1,2,4]triazin-3-yl]methoxy]quinoline |
| SMILES | COc1ccc2c(OCc3nnc4ncc(-c5ccc([N+](=O)[O-])cc5)nn34)ccnc2c1 |
| InChI | InChI=1S/C21H15N7O4/c1-31-15-6-7-16-17(10-15)22-9-8-19(16)32-12-20-24-25-21-23-11-18(26-27(20)21)13-2-4-14(5-3-13)28(29)30/h2-11H,12H2,1H3 |
| InChIKey | CHKCXFQBHMELIO-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 130.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.40 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|