C31H25N5O2 — CID 76749660
7-(3-but-2-enoxyphenyl)-4-[(6-phenyl-[1,2,4]triazolo[4,3-b]pyridazin-3-yl)methoxy]quinoline (PubChem CID 76749660) has the molecular formula C31H25N5O2 and a molecular weight of 499.57 g/mol. Its IUPAC name is 7-(3-but-2-enoxyphenyl)-4-[(6-phenyl-[1,2,4]triazolo[4,3-b]pyridazin-3-yl)methoxy]quinoline.
| Compound Name | 7-(3-but-2-enoxyphenyl)-4-[(6-phenyl-[1,2,4]triazolo[4,3-b]pyridazin-3-yl)methoxy]quinoline |
|---|---|
| PubChem CID | 76749660 |
| Molecular Formula | C31H25N5O2 |
| Molecular Weight | 499.57 g/mol |
| Exact Mass | 499.20 |
| IUPAC Name | 7-(3-but-2-enoxyphenyl)-4-[(6-phenyl-[1,2,4]triazolo[4,3-b]pyridazin-3-yl)methoxy]quinoline |
| SMILES | CC=CCOc1cccc(-c2ccc3c(OCc4nnc5ccc(-c6ccccc6)nn45)ccnc3c2)c1 |
| InChI | InChI=1S/C31H25N5O2/c1-2-3-18-37-25-11-7-10-23(19-25)24-12-13-26-28(20-24)32-17-16-29(26)38-21-31-34-33-30-15-14-27(35-36(30)31)22-8-5-4-6-9-22/h2-17,19-20H,18,21H2,1H3 |
| InChIKey | VSZQHCPKNHQASZ-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 74.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.57 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|