C13H7I2NS2 — CID 57407540
2,5-bis(5-iodothiophen-2-yl)pyridine (PubChem CID 57407540) has the molecular formula C13H7I2NS2 and a molecular weight of 495.15 g/mol. Its IUPAC name is 2,5-bis(5-iodothiophen-2-yl)pyridine.
| Compound Name | 2,5-bis(5-iodothiophen-2-yl)pyridine |
|---|---|
| PubChem CID | 57407540 |
| Molecular Formula | C13H7I2NS2 |
| Molecular Weight | 495.15 g/mol |
| Exact Mass | 494.81 |
| IUPAC Name | 2,5-bis(5-iodothiophen-2-yl)pyridine |
| SMILES | Ic1ccc(-c2ccc(-c3ccc(I)s3)nc2)s1 |
| InChI | InChI=1S/C13H7I2NS2/c14-12-5-3-10(17-12)8-1-2-9(16-7-8)11-4-6-13(15)18-11/h1-7H |
| InChIKey | LETSXDBGTMOGIU-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.15 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|