C15H12N2OS — CID 91276882
2-methyl-5-(6-pyridin-4-yl-3-pyridinyl)thiophen-3-ol (PubChem CID 91276882) has the molecular formula C15H12N2OS and a molecular weight of 268.34 g/mol. Its IUPAC name is 2-methyl-5-(6-pyridin-4-yl-3-pyridinyl)thiophen-3-ol.
| Compound Name | 2-methyl-5-(6-pyridin-4-yl-3-pyridinyl)thiophen-3-ol |
|---|---|
| PubChem CID | 91276882 |
| Molecular Formula | C15H12N2OS |
| Molecular Weight | 268.34 g/mol |
| Exact Mass | 268.07 |
| IUPAC Name | 2-methyl-5-(6-pyridin-4-yl-3-pyridinyl)thiophen-3-ol |
| SMILES | Cc1sc(-c2ccc(-c3ccncc3)nc2)cc1O |
| InChI | InChI=1S/C15H12N2OS/c1-10-14(18)8-15(19-10)12-2-3-13(17-9-12)11-4-6-16-7-5-11/h2-9,18H,1H3 |
| InChIKey | DXYPOCIZFANXCE-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.34 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'} |
|---|