C32H20N8 — CID 118564710
3,11-bis(6-pyridin-4-yl-3-pyridinyl)-2,5,10,13-tetrazatricyclo[10.4.0.04,9]hexadeca-1(12),2,4(9),5,7,10,13,15-octaene (PubChem CID 118564710) has the molecular formula C32H20N8 and a molecular weight of 516.57 g/mol. Its IUPAC name is 3,11-bis(6-pyridin-4-yl-3-pyridinyl)-2,5,10,13-tetrazatricyclo[10.4.0.04,9]hexadeca-1(12),2,4(9),5,7,10,13,15-octaene.
| Compound Name | 3,11-bis(6-pyridin-4-yl-3-pyridinyl)-2,5,10,13-tetrazatricyclo[10.4.0.04,9]hexadeca-1(12),2,4(9),5,7,10,13,15-octaene |
|---|---|
| PubChem CID | 118564710 |
| Molecular Formula | C32H20N8 |
| Molecular Weight | 516.57 g/mol |
| Exact Mass | 516.18 |
| IUPAC Name | 3,11-bis(6-pyridin-4-yl-3-pyridinyl)-2,5,10,13-tetrazatricyclo[10.4.0.04,9]hexadeca-1(12),2,4(9),5,7,10,13,15-octaene |
| SMILES | c1cnc2c(c1)/N=C(/c1ccc(-c3ccncc3)nc1)c1ncccc1/N=C\2c1ccc(-c2ccncc2)nc1 |
| InChI | InChI=1S/C32H20N8/c1-3-27-31(35-13-1)29(23-5-7-25(37-19-23)21-9-15-33-16-10-21)40-28-4-2-14-36-32(28)30(39-27)24-6-8-26(38-20-24)22-11-17-34-18-12-22/h1-20H/b31-29+,32-30+,39-27-,39-30-,40-28-,40-29- |
| InChIKey | MNBMFYVDCDFMIF-VBNSXUIPSA-N |
| XLogP | 6.04 |
| TPSA | 102.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.57 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |