C38H26N4 — CID 156509384
2,3-diphenyl-5-(5-phenyl-2-pyridinyl)-6-(4-pyridin-4-ylphenyl)pyrazine (PubChem CID 156509384) has the molecular formula C38H26N4 and a molecular weight of 538.65 g/mol. Its IUPAC name is 2,3-diphenyl-5-(5-phenyl-2-pyridinyl)-6-(4-pyridin-4-ylphenyl)pyrazine.
| Compound Name | 2,3-diphenyl-5-(5-phenyl-2-pyridinyl)-6-(4-pyridin-4-ylphenyl)pyrazine |
|---|---|
| PubChem CID | 156509384 |
| Molecular Formula | C38H26N4 |
| Molecular Weight | 538.65 g/mol |
| Exact Mass | 538.22 |
| IUPAC Name | 2,3-diphenyl-5-(5-phenyl-2-pyridinyl)-6-(4-pyridin-4-ylphenyl)pyrazine |
| SMILES | c1ccc(-c2ccc(-c3nc(-c4ccccc4)c(-c4ccccc4)nc3-c3ccc(-c4ccncc4)cc3)nc2)cc1 |
| InChI | InChI=1S/C38H26N4/c1-4-10-27(11-5-1)33-20-21-34(40-26-33)38-37(32-18-16-28(17-19-32)29-22-24-39-25-23-29)41-35(30-12-6-2-7-13-30)36(42-38)31-14-8-3-9-15-31/h1-26H |
| InChIKey | RIQJABAYCAQLCJ-UHFFFAOYSA-N |
| XLogP | 9.27 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.65 |
| LogP ≤ 5 | 9.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |