C25H22F9IO — CID 57407695
3-(2-benzyl-1-iodo-3-phenylprop-1-enyl)-4-(2,2,3,3,4,4,5,5,5-nonafluoropentyl)oxolane (PubChem CID 57407695) has the molecular formula C25H22F9IO and a molecular weight of 636.34 g/mol. Its IUPAC name is 3-(2-benzyl-1-iodo-3-phenylprop-1-enyl)-4-(2,2,3,3,4,4,5,5,5-nonafluoropentyl)oxolane.
| Compound Name | 3-(2-benzyl-1-iodo-3-phenylprop-1-enyl)-4-(2,2,3,3,4,4,5,5,5-nonafluoropentyl)oxolane |
|---|---|
| PubChem CID | 57407695 |
| Molecular Formula | C25H22F9IO |
| Molecular Weight | 636.34 g/mol |
| Exact Mass | 636.06 |
| IUPAC Name | 3-(2-benzyl-1-iodo-3-phenylprop-1-enyl)-4-(2,2,3,3,4,4,5,5,5-nonafluoropentyl)oxolane |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)CC1COCC1C(I)=C(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C25H22F9IO/c26-22(27,23(28,29)24(30,31)25(32,33)34)13-19-14-36-15-20(19)21(35)18(11-16-7-3-1-4-8-16)12-17-9-5-2-6-10-17/h1-10,19-20H,11-15H2 |
| InChIKey | DGHVGEIFNLVKLH-UHFFFAOYSA-N |
| XLogP | 8.28 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.34 |
| LogP ≤ 5 | 8.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|