C17H22N2O3 — CID 57408175
methyl 4-[(5S,6S)-3-butyl-5-cyano-1,3-oxazinan-6-yl]benzoate (PubChem CID 57408175) has the molecular formula C17H22N2O3 and a molecular weight of 302.37 g/mol. Its IUPAC name is methyl 4-[(5S,6S)-3-butyl-5-cyano-1,3-oxazinan-6-yl]benzoate.
| Compound Name | methyl 4-[(5S,6S)-3-butyl-5-cyano-1,3-oxazinan-6-yl]benzoate |
|---|---|
| PubChem CID | 57408175 |
| Molecular Formula | C17H22N2O3 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | methyl 4-[(5S,6S)-3-butyl-5-cyano-1,3-oxazinan-6-yl]benzoate |
| SMILES | CCCCN1CO[C@H](c2ccc(C(=O)OC)cc2)[C@H](C#N)C1 |
| InChI | InChI=1S/C17H22N2O3/c1-3-4-9-19-11-15(10-18)16(22-12-19)13-5-7-14(8-6-13)17(20)21-2/h5-8,15-16H,3-4,9,11-12H2,1-2H3/t15-,16-/m1/s1 |
| InChIKey | NUIBRXLTQKVCEC-HZPDHXFCSA-N |
| XLogP | 2.74 |
| TPSA | 62.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |