C15H16O4 — CID 57408431
methyl 4-[(1S,2S)-2-[(E)-2-acetyloxyethenyl]cyclopropyl]benzoate (PubChem CID 57408431) has the molecular formula C15H16O4 and a molecular weight of 260.29 g/mol. Its IUPAC name is methyl 4-[(1S,2S)-2-[(E)-2-acetyloxyethenyl]cyclopropyl]benzoate.
| Compound Name | methyl 4-[(1S,2S)-2-[(E)-2-acetyloxyethenyl]cyclopropyl]benzoate |
|---|---|
| PubChem CID | 57408431 |
| Molecular Formula | C15H16O4 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | methyl 4-[(1S,2S)-2-[(E)-2-acetyloxyethenyl]cyclopropyl]benzoate |
| SMILES | COC(=O)c1ccc([C@H]2C[C@@H]2/C=C/OC(C)=O)cc1 |
| InChI | InChI=1S/C15H16O4/c1-10(16)19-8-7-13-9-14(13)11-3-5-12(6-4-11)15(17)18-2/h3-8,13-14H,9H2,1-2H3/b8-7+/t13-,14+/m0/s1 |
| InChIKey | FLSMESCOLNGKNB-JYASZMECSA-N |
| XLogP | 2.65 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|