C13H11N3OS — CID 57409199
4-(4,5-dimethyl-1,3-thiazol-2-yl)-2H-phthalazin-1-one (PubChem CID 57409199) has the molecular formula C13H11N3OS and a molecular weight of 257.32 g/mol. Its IUPAC name is 4-(4,5-dimethyl-1,3-thiazol-2-yl)-2H-phthalazin-1-one.
| Compound Name | 4-(4,5-dimethyl-1,3-thiazol-2-yl)-2H-phthalazin-1-one |
|---|---|
| PubChem CID | 57409199 |
| Molecular Formula | C13H11N3OS |
| Molecular Weight | 257.32 g/mol |
| Exact Mass | 257.06 |
| IUPAC Name | 4-(4,5-dimethyl-1,3-thiazol-2-yl)-2H-phthalazin-1-one |
| SMILES | Cc1nc(-c2n[nH]c(=O)c3ccccc23)sc1C |
| InChI | InChI=1S/C13H11N3OS/c1-7-8(2)18-13(14-7)11-9-5-3-4-6-10(9)12(17)16-15-11/h3-6H,1-2H3,(H,16,17) |
| InChIKey | CIEZOXNFVYMKGF-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.32 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |