C17H12N4O2 — CID 95910199
4-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]-2H-phthalazin-1-one (PubChem CID 95910199) has the molecular formula C17H12N4O2 and a molecular weight of 304.31 g/mol. Its IUPAC name is 4-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]-2H-phthalazin-1-one.
| Compound Name | 4-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]-2H-phthalazin-1-one |
|---|---|
| PubChem CID | 95910199 |
| Molecular Formula | C17H12N4O2 |
| Molecular Weight | 304.31 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | 4-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]-2H-phthalazin-1-one |
| SMILES | Cc1ccc(-c2noc(-c3n[nH]c(=O)c4ccccc34)n2)cc1 |
| InChI | InChI=1S/C17H12N4O2/c1-10-6-8-11(9-7-10)15-18-17(23-21-15)14-12-4-2-3-5-13(12)16(22)20-19-14/h2-9H,1H3,(H,20,22) |
| InChIKey | NFKQJXQZTRDKIV-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 84.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.31 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |