C25H28N2O3 — CID 57412597
(4R,4aR,7S,7aR,12bS)-9-[(4-methoxyphenyl)methylamino]-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-ol (PubChem CID 57412597) has the molecular formula C25H28N2O3 and a molecular weight of 404.51 g/mol. Its IUPAC name is (4R,4aR,7S,7aR,12bS)-9-[(4-methoxyphenyl)methylamino]-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-ol.
| Compound Name | (4R,4aR,7S,7aR,12bS)-9-[(4-methoxyphenyl)methylamino]-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-ol |
|---|---|
| PubChem CID | 57412597 |
| Molecular Formula | C25H28N2O3 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.21 |
| IUPAC Name | (4R,4aR,7S,7aR,12bS)-9-[(4-methoxyphenyl)methylamino]-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-ol |
| SMILES | COc1ccc(CNc2ccc3c4c2O[C@H]2[C@@H](O)C=C[C@H]5[C@@H](C3)N(C)CC[C@@]452)cc1 |
| InChI | InChI=1S/C25H28N2O3/c1-27-12-11-25-18-8-10-21(28)24(25)30-23-19(9-5-16(22(23)25)13-20(18)27)26-14-15-3-6-17(29-2)7-4-15/h3-10,18,20-21,24,26,28H,11-14H2,1-2H3/t18-,20+,21-,24-,25-/m0/s1 |
| InChIKey | CQNRBAWGNFQSTA-YXXKPLBDSA-N |
| XLogP | 3.11 |
| TPSA | 53.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|