C18H20N4O2S2 — CID 57413470
2-[6-methoxy-7-(2-pyrrolidin-1-ylethoxy)quinazolin-4-yl]sulfanyl-1,3-thiazole (PubChem CID 57413470) has the molecular formula C18H20N4O2S2 and a molecular weight of 388.52 g/mol. Its IUPAC name is 2-[6-methoxy-7-(2-pyrrolidin-1-ylethoxy)quinazolin-4-yl]sulfanyl-1,3-thiazole.
| Compound Name | 2-[6-methoxy-7-(2-pyrrolidin-1-ylethoxy)quinazolin-4-yl]sulfanyl-1,3-thiazole |
|---|---|
| PubChem CID | 57413470 |
| Molecular Formula | C18H20N4O2S2 |
| Molecular Weight | 388.52 g/mol |
| Exact Mass | 388.10 |
| IUPAC Name | 2-[6-methoxy-7-(2-pyrrolidin-1-ylethoxy)quinazolin-4-yl]sulfanyl-1,3-thiazole |
| SMILES | COc1cc2c(Sc3nccs3)ncnc2cc1OCCN1CCCC1 |
| InChI | InChI=1S/C18H20N4O2S2/c1-23-15-10-13-14(11-16(15)24-8-7-22-5-2-3-6-22)20-12-21-17(13)26-18-19-4-9-25-18/h4,9-12H,2-3,5-8H2,1H3 |
| InChIKey | XMZQEVXFTMIAOR-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 60.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.52 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'} |
|---|