C13H16N6O3 — CID 57413917
4-amino-1-[(3R,5R,7S)-4,8-dioxa-1,12,13-triazatricyclo[8.3.0.03,7]trideca-10,12-dien-5-yl]-5-methylpyrimidin-2-one (PubChem CID 57413917) has the molecular formula C13H16N6O3 and a molecular weight of 304.31 g/mol. Its IUPAC name is 4-amino-1-[(3R,5R,7S)-4,8-dioxa-1,12,13-triazatricyclo[8.3.0.03,7]trideca-10,12-dien-5-yl]-5-methylpyrimidin-2-one.
| Compound Name | 4-amino-1-[(3R,5R,7S)-4,8-dioxa-1,12,13-triazatricyclo[8.3.0.03,7]trideca-10,12-dien-5-yl]-5-methylpyrimidin-2-one |
|---|---|
| PubChem CID | 57413917 |
| Molecular Formula | C13H16N6O3 |
| Molecular Weight | 304.31 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | 4-amino-1-[(3R,5R,7S)-4,8-dioxa-1,12,13-triazatricyclo[8.3.0.03,7]trideca-10,12-dien-5-yl]-5-methylpyrimidin-2-one |
| SMILES | Cc1cn([C@H]2C[C@@H]3OCc4cnnn4C[C@H]3O2)c(=O)nc1N |
| InChI | InChI=1S/C13H16N6O3/c1-7-4-18(13(20)16-12(7)14)11-2-9-10(22-11)5-19-8(6-21-9)3-15-17-19/h3-4,9-11H,2,5-6H2,1H3,(H2,14,16,20)/t9-,10+,11+/m0/s1 |
| InChIKey | WLRGTZXHZPDARA-HBNTYKKESA-N |
| XLogP | -0.39 |
| TPSA | 110.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.31 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |