C20H20N2O6 — CID 57414137
(2R,3S,4S,5S,6R)-2-(hydroxymethyl)-6-(4-quinazolin-6-ylphenoxy)oxane-3,4,5-triol (PubChem CID 57414137) has the molecular formula C20H20N2O6 and a molecular weight of 384.39 g/mol. Its IUPAC name is (2R,3S,4S,5S,6R)-2-(hydroxymethyl)-6-(4-quinazolin-6-ylphenoxy)oxane-3,4,5-triol.
| Compound Name | (2R,3S,4S,5S,6R)-2-(hydroxymethyl)-6-(4-quinazolin-6-ylphenoxy)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 57414137 |
| Molecular Formula | C20H20N2O6 |
| Molecular Weight | 384.39 g/mol |
| Exact Mass | 384.13 |
| IUPAC Name | (2R,3S,4S,5S,6R)-2-(hydroxymethyl)-6-(4-quinazolin-6-ylphenoxy)oxane-3,4,5-triol |
| SMILES | OC[C@H]1O[C@H](Oc2ccc(-c3ccc4ncncc4c3)cc2)[C@@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C20H20N2O6/c23-9-16-17(24)18(25)19(26)20(28-16)27-14-4-1-11(2-5-14)12-3-6-15-13(7-12)8-21-10-22-15/h1-8,10,16-20,23-26H,9H2/t16-,17-,18+,19+,20+/m1/s1 |
| InChIKey | GTJKYOTVBQGSRY-SLHNCBLASA-N |
| XLogP | 0.48 |
| TPSA | 125.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.39 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |