C30H31F3N2O5 — CID 57414973
2-[4-[(E)-C-benzyl-N-[[4-(trifluoromethoxy)phenyl]methoxy]carbonimidoyl]phenoxy]-N-(oxan-4-ylmethyl)acetamide (PubChem CID 57414973) has the molecular formula C30H31F3N2O5 and a molecular weight of 556.58 g/mol. Its IUPAC name is 2-[4-[(E)-C-benzyl-N-[[4-(trifluoromethoxy)phenyl]methoxy]carbonimidoyl]phenoxy]-N-(oxan-4-ylmethyl)acetamide.
| Compound Name | 2-[4-[(E)-C-benzyl-N-[[4-(trifluoromethoxy)phenyl]methoxy]carbonimidoyl]phenoxy]-N-(oxan-4-ylmethyl)acetamide |
|---|---|
| PubChem CID | 57414973 |
| Molecular Formula | C30H31F3N2O5 |
| Molecular Weight | 556.58 g/mol |
| Exact Mass | 556.22 |
| IUPAC Name | 2-[4-[(E)-C-benzyl-N-[[4-(trifluoromethoxy)phenyl]methoxy]carbonimidoyl]phenoxy]-N-(oxan-4-ylmethyl)acetamide |
| SMILES | O=C(COc1ccc(/C(Cc2ccccc2)=N/OCc2ccc(OC(F)(F)F)cc2)cc1)NCC1CCOCC1 |
| InChI | InChI=1S/C30H31F3N2O5/c31-30(32,33)40-27-10-6-24(7-11-27)20-39-35-28(18-22-4-2-1-3-5-22)25-8-12-26(13-9-25)38-21-29(36)34-19-23-14-16-37-17-15-23/h1-13,23H,14-21H2,(H,34,36)/b35-28+ |
| InChIKey | KFRWCKVFEPNJBA-AWQADKOQSA-N |
| XLogP | 5.67 |
| TPSA | 78.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.58 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|