About 5-amino-N-(6-methoxy-1,5-naphthyridin-4-yl)-6-oxopiperidine-2-carboxamide
5-amino-N-(6-methoxy-1,5-naphthyridin-4-yl)-6-oxopiperidine-2-carboxamide (PubChem CID 57418806) has the molecular formula C15H17N5O3
and a molecular weight of 315.33 g/mol. Its IUPAC name is 5-amino-N-(6-methoxy-1,5-naphthyridin-4-yl)-6-oxopiperidine-2-carboxamide.
Molecular Properties
| Compound Name | 5-amino-N-(6-methoxy-1,5-naphthyridin-4-yl)-6-oxopiperidine-2-carboxamide |
| PubChem CID | 57418806 |
| Molecular Formula | C15H17N5O3 |
| Molecular Weight | 315.33 g/mol |
| Exact Mass | 315.13 |
| IUPAC Name | 5-amino-N-(6-methoxy-1,5-naphthyridin-4-yl)-6-oxopiperidine-2-carboxamide |
| SMILES | COc1ccc2nccc(NC(=O)C3CCC(N)C(=O)N3)c2n1 |
| InChI | InChI=1S/C15H17N5O3/c1-23-12-5-4-9-13(20-12)10(6-7-17-9)18-15(22)11-3-2-8(16)14(21)19-11/h4-8,11H,2-3,16H2,1H3,(H,19,21)(H,17,18,22) |
| InChIKey | LLEHRZYWHGWOBZ-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 119.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.33 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-amino-N-(6-methoxy-1,5-naphthyridin-4-yl)-6-oxopiperidine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-N-(6-methoxy-1,5-naphthyridin-4-yl)-6-oxopiperidine-2-carboxamide?
The IUPAC name of 5-amino-N-(6-methoxy-1,5-naphthyridin-4-yl)-6-oxopiperidine-2-carboxamide (CID 57418806) is 5-amino-N-(6-methoxy-1,5-naphthyridin-4-yl)-6-oxopiperidine-2-carboxamide.
What is the SMILES notation for 5-amino-N-(6-methoxy-1,5-naphthyridin-4-yl)-6-oxopiperidine-2-carboxamide?
The canonical SMILES for 5-amino-N-(6-methoxy-1,5-naphthyridin-4-yl)-6-oxopiperidine-2-carboxamide is COc1ccc2nccc(NC(=O)C3CCC(N)C(=O)N3)c2n1.
What is the InChIKey of 5-amino-N-(6-methoxy-1,5-naphthyridin-4-yl)-6-oxopiperidine-2-carboxamide?
The InChIKey is LLEHRZYWHGWOBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17N5O3/c1-23-12-5-4-9-13(20-12)10(6-7-17-9)18-15(22)11-3-2-8(16)14(21)19-11/h4-8,11H,2-3,16H2,1H3,(H,19,21)(H,17,18,22).
What are the key properties of 5-amino-N-(6-methoxy-1,5-naphthyridin-4-yl)-6-oxopiperidine-2-carboxamide?
5-amino-N-(6-methoxy-1,5-naphthyridin-4-yl)-6-oxopiperidine-2-carboxamide has a molecular weight of 315.33 g/mol, XLogP of 0.18, 3 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-N-(6-methoxy-1,5-naphthyridin-4-yl)-6-oxopiperidine-2-carboxamide is sourced from PubChem (CID 57418806), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).