C27H33FN6O4S — CID 142817627
(1R)-4-[(7-fluoro-3-oxo-4,9-dihydro-[1,4]thiazino[3,2-b]azepin-6-yl)methylamino]-N-(6-methoxy-1,5-naphthyridin-4-yl)cycloheptane-1-carboxamide;methanol (PubChem CID 142817627) has the molecular formula C27H33FN6O4S and a molecular weight of 556.66 g/mol. Its IUPAC name is (1R)-4-[(7-fluoro-3-oxo-4,9-dihydro-[1,4]thiazino[3,2-b]azepin-6-yl)methylamino]-N-(6-methoxy-1,5-naphthyridin-4-yl)cycloheptane-1-carboxamide;methanol.
| Compound Name | (1R)-4-[(7-fluoro-3-oxo-4,9-dihydro-[1,4]thiazino[3,2-b]azepin-6-yl)methylamino]-N-(6-methoxy-1,5-naphthyridin-4-yl)cycloheptane-1-carboxamide;methanol |
|---|---|
| PubChem CID | 142817627 |
| Molecular Formula | C27H33FN6O4S |
| Molecular Weight | 556.66 g/mol |
| Exact Mass | 556.23 |
| IUPAC Name | (1R)-4-[(7-fluoro-3-oxo-4,9-dihydro-[1,4]thiazino[3,2-b]azepin-6-yl)methylamino]-N-(6-methoxy-1,5-naphthyridin-4-yl)cycloheptane-1-carboxamide;methanol |
| SMILES | CO.COc1ccc2nccc(NC(=O)[C@@H]3CCCC(NCC4=NC5=C(CC=C4F)SCC(=O)N5)CC3)c2n1 |
| InChI | InChI=1S/C26H29FN6O3S.CH4O/c1-36-23-10-8-18-24(33-23)19(11-12-28-18)31-26(35)15-3-2-4-16(6-5-15)29-13-20-17(27)7-9-21-25(30-20)32-22(34)14-37-21;1-2/h7-8,10-12,15-16,29H,2-6,9,13-14H2,1H3,(H,32,34)(H,28,31,35);2H,1H3/t15-,16?;/m1./s1 |
| InChIKey | IAINBFAWAFPBOP-PGZQCDFOSA-N |
| XLogP | 3.45 |
| TPSA | 137.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.66 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |