C7H16NO4S- — CID 57419764
1,3-diethoxy-2-(sulfinatoamino)propane (PubChem CID 57419764) has the molecular formula C7H16NO4S- and a molecular weight of 210.27 g/mol. Its IUPAC name is 1,3-diethoxy-2-(sulfinatoamino)propane.
| Compound Name | 1,3-diethoxy-2-(sulfinatoamino)propane |
|---|---|
| PubChem CID | 57419764 |
| Molecular Formula | C7H16NO4S- |
| Molecular Weight | 210.27 g/mol |
| Exact Mass | 210.08 |
| IUPAC Name | 1,3-diethoxy-2-(sulfinatoamino)propane |
| SMILES | CCOCC(COCC)NS(=O)[O-] |
| InChI | InChI=1S/C7H17NO4S/c1-3-11-5-7(6-12-4-2)8-13(9)10/h7-8H,3-6H2,1-2H3,(H,9,10)/p-1 |
| InChIKey | MQPJERZTTNKJHP-UHFFFAOYSA-M |
| XLogP | -0.19 |
| TPSA | 70.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.27 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|