C14H17NO5 — CID 57421469
1-(3,3-diethoxyprop-1-ynyl)-2-methoxy-4-nitrobenzene (PubChem CID 57421469) has the molecular formula C14H17NO5 and a molecular weight of 279.29 g/mol. Its IUPAC name is 1-(3,3-diethoxyprop-1-ynyl)-2-methoxy-4-nitrobenzene.
| Compound Name | 1-(3,3-diethoxyprop-1-ynyl)-2-methoxy-4-nitrobenzene |
|---|---|
| PubChem CID | 57421469 |
| Molecular Formula | C14H17NO5 |
| Molecular Weight | 279.29 g/mol |
| Exact Mass | 279.11 |
| IUPAC Name | 1-(3,3-diethoxyprop-1-ynyl)-2-methoxy-4-nitrobenzene |
| SMILES | CCOC(C#Cc1ccc([N+](=O)[O-])cc1OC)OCC |
| InChI | InChI=1S/C14H17NO5/c1-4-19-14(20-5-2)9-7-11-6-8-12(15(16)17)10-13(11)18-3/h6,8,10,14H,4-5H2,1-3H3 |
| InChIKey | MNDUWLHEQUNAAT-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 70.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.29 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|