C19H25N3O2 — CID 57423871
(8R,9R,10S,13S,14S)-10-(azidomethyl)-13-methyl-5,6,7,8,9,11,12,14,15,16-decahydro-4H-cyclopenta[a]phenanthrene-3,17-dione (PubChem CID 57423871) has the molecular formula C19H25N3O2 and a molecular weight of 327.43 g/mol. Its IUPAC name is (8R,9R,10S,13S,14S)-10-(azidomethyl)-13-methyl-5,6,7,8,9,11,12,14,15,16-decahydro-4H-cyclopenta[a]phenanthrene-3,17-dione.
| Compound Name | (8R,9R,10S,13S,14S)-10-(azidomethyl)-13-methyl-5,6,7,8,9,11,12,14,15,16-decahydro-4H-cyclopenta[a]phenanthrene-3,17-dione |
|---|---|
| PubChem CID | 57423871 |
| Molecular Formula | C19H25N3O2 |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.19 |
| IUPAC Name | (8R,9R,10S,13S,14S)-10-(azidomethyl)-13-methyl-5,6,7,8,9,11,12,14,15,16-decahydro-4H-cyclopenta[a]phenanthrene-3,17-dione |
| SMILES | C[C@]12CC[C@@H]3[C@@H](CCC4CC(=O)C=C[C@@]43CN=[N+]=[N-])[C@@H]1CCC2=O |
| InChI | InChI=1S/C19H25N3O2/c1-18-8-7-16-14(15(18)4-5-17(18)24)3-2-12-10-13(23)6-9-19(12,16)11-21-22-20/h6,9,12,14-16H,2-5,7-8,10-11H2,1H3/t12?,14-,15-,16+,18-,19+/m0/s1 |
| InChIKey | FTRZUGIOVBVGRU-GKAQTUBLSA-N |
| XLogP | 4.23 |
| TPSA | 82.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|