C19H26O2S — CID 88708557
(8S,9R,10S,13S,14S)-13-methyl-10-(sulfanylmethyl)-5,6,7,8,9,11,12,14,15,16-decahydro-4H-cyclopenta[a]phenanthrene-3,17-dione (PubChem CID 88708557) has the molecular formula C19H26O2S and a molecular weight of 318.48 g/mol. Its IUPAC name is (8S,9R,10S,13S,14S)-13-methyl-10-(sulfanylmethyl)-5,6,7,8,9,11,12,14,15,16-decahydro-4H-cyclopenta[a]phenanthrene-3,17-dione.
| Compound Name | (8S,9R,10S,13S,14S)-13-methyl-10-(sulfanylmethyl)-5,6,7,8,9,11,12,14,15,16-decahydro-4H-cyclopenta[a]phenanthrene-3,17-dione |
|---|---|
| PubChem CID | 88708557 |
| Molecular Formula | C19H26O2S |
| Molecular Weight | 318.48 g/mol |
| Exact Mass | 318.17 |
| IUPAC Name | (8S,9R,10S,13S,14S)-13-methyl-10-(sulfanylmethyl)-5,6,7,8,9,11,12,14,15,16-decahydro-4H-cyclopenta[a]phenanthrene-3,17-dione |
| SMILES | C[C@]12CC[C@@H]3[C@@H](CCC4CC(=O)C=C[C@@]43CS)[C@@H]1CCC2=O |
| InChI | InChI=1S/C19H26O2S/c1-18-8-7-16-14(15(18)4-5-17(18)21)3-2-12-10-13(20)6-9-19(12,16)11-22/h6,9,12,14-16,22H,2-5,7-8,10-11H2,1H3/t12?,14-,15-,16+,18-,19+/m0/s1 |
| InChIKey | XVJPFDSXDASBMA-GKAQTUBLSA-N |
| XLogP | 3.85 |
| TPSA | 34.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.48 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|