About 3-bromo-2-methyl-5,6-dihydro-4H-cyclopenta[c]pyrazole
3-bromo-2-methyl-5,6-dihydro-4H-cyclopenta[c]pyrazole (PubChem CID 57425052) has the molecular formula C7H9BrN2
and a molecular weight of 201.07 g/mol. Its IUPAC name is 3-bromo-2-methyl-5,6-dihydro-4H-cyclopenta[c]pyrazole.
Analyze 3-bromo-2-methyl-5,6-dihydro-4H-cyclopenta[c]pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-2-methyl-5,6-dihydro-4H-cyclopenta[c]pyrazole?
The IUPAC name of 3-bromo-2-methyl-5,6-dihydro-4H-cyclopenta[c]pyrazole (CID 57425052) is 3-bromo-2-methyl-5,6-dihydro-4H-cyclopenta[c]pyrazole.
What is the SMILES notation for 3-bromo-2-methyl-5,6-dihydro-4H-cyclopenta[c]pyrazole?
The canonical SMILES for 3-bromo-2-methyl-5,6-dihydro-4H-cyclopenta[c]pyrazole is Cn1nc2c(c1Br)CCC2.
What is the InChIKey of 3-bromo-2-methyl-5,6-dihydro-4H-cyclopenta[c]pyrazole?
The InChIKey is NZOHXUPPFVGHAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9BrN2/c1-10-7(8)5-3-2-4-6(5)9-10/h2-4H2,1H3.
What are the key properties of 3-bromo-2-methyl-5,6-dihydro-4H-cyclopenta[c]pyrazole?
3-bromo-2-methyl-5,6-dihydro-4H-cyclopenta[c]pyrazole has a molecular weight of 201.07 g/mol, XLogP of 1.67, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-2-methyl-5,6-dihydro-4H-cyclopenta[c]pyrazole is sourced from PubChem (CID 57425052), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).