C18H16BrN3 — CID 57425763
1-(3-bromophenyl)-2,2-dipyridin-3-ylethanamine (PubChem CID 57425763) has the molecular formula C18H16BrN3 and a molecular weight of 354.25 g/mol. Its IUPAC name is 1-(3-bromophenyl)-2,2-dipyridin-3-ylethanamine.
| Compound Name | 1-(3-bromophenyl)-2,2-dipyridin-3-ylethanamine |
|---|---|
| PubChem CID | 57425763 |
| Molecular Formula | C18H16BrN3 |
| Molecular Weight | 354.25 g/mol |
| Exact Mass | 353.05 |
| IUPAC Name | 1-(3-bromophenyl)-2,2-dipyridin-3-ylethanamine |
| SMILES | NC(c1cccc(Br)c1)C(c1cccnc1)c1cccnc1 |
| InChI | InChI=1S/C18H16BrN3/c19-16-7-1-4-13(10-16)18(20)17(14-5-2-8-21-11-14)15-6-3-9-22-12-15/h1-12,17-18H,20H2 |
| InChIKey | KTTRJFMNHJSHHW-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.25 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |