C25H21BrN4O — CID 66962975
1-[1-(3-bromophenyl)-2,2-dipyridin-3-ylethyl]-3-phenylurea (PubChem CID 66962975) has the molecular formula C25H21BrN4O and a molecular weight of 473.37 g/mol. Its IUPAC name is 1-[1-(3-bromophenyl)-2,2-dipyridin-3-ylethyl]-3-phenylurea.
| Compound Name | 1-[1-(3-bromophenyl)-2,2-dipyridin-3-ylethyl]-3-phenylurea |
|---|---|
| PubChem CID | 66962975 |
| Molecular Formula | C25H21BrN4O |
| Molecular Weight | 473.37 g/mol |
| Exact Mass | 472.09 |
| IUPAC Name | 1-[1-(3-bromophenyl)-2,2-dipyridin-3-ylethyl]-3-phenylurea |
| SMILES | O=C(Nc1ccccc1)NC(c1cccc(Br)c1)C(c1cccnc1)c1cccnc1 |
| InChI | InChI=1S/C25H21BrN4O/c26-21-10-4-7-18(15-21)24(30-25(31)29-22-11-2-1-3-12-22)23(19-8-5-13-27-16-19)20-9-6-14-28-17-20/h1-17,23-24H,(H2,29,30,31) |
| InChIKey | ACWMBXNRWZXAEV-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.37 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |