C27H23N5O — CID 66962978
1-benzyl-3-[1-(3-cyanophenyl)-2,2-dipyridin-3-ylethyl]urea (PubChem CID 66962978) has the molecular formula C27H23N5O and a molecular weight of 433.52 g/mol. Its IUPAC name is 1-benzyl-3-[1-(3-cyanophenyl)-2,2-dipyridin-3-ylethyl]urea.
| Compound Name | 1-benzyl-3-[1-(3-cyanophenyl)-2,2-dipyridin-3-ylethyl]urea |
|---|---|
| PubChem CID | 66962978 |
| Molecular Formula | C27H23N5O |
| Molecular Weight | 433.52 g/mol |
| Exact Mass | 433.19 |
| IUPAC Name | 1-benzyl-3-[1-(3-cyanophenyl)-2,2-dipyridin-3-ylethyl]urea |
| SMILES | N#Cc1cccc(C(NC(=O)NCc2ccccc2)C(c2cccnc2)c2cccnc2)c1 |
| InChI | InChI=1S/C27H23N5O/c28-16-21-9-4-10-22(15-21)26(32-27(33)31-17-20-7-2-1-3-8-20)25(23-11-5-13-29-18-23)24-12-6-14-30-19-24/h1-15,18-19,25-26H,17H2,(H2,31,32,33) |
| InChIKey | YAWQPRNKOIZOLC-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.52 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |