C26H28N4 — CID 66962800
3-[1-(2,2-dimethylpent-4-enylamino)-2,2-dipyridin-3-ylethyl]benzonitrile (PubChem CID 66962800) has the molecular formula C26H28N4 and a molecular weight of 396.54 g/mol. Its IUPAC name is 3-[1-(2,2-dimethylpent-4-enylamino)-2,2-dipyridin-3-ylethyl]benzonitrile.
| Compound Name | 3-[1-(2,2-dimethylpent-4-enylamino)-2,2-dipyridin-3-ylethyl]benzonitrile |
|---|---|
| PubChem CID | 66962800 |
| Molecular Formula | C26H28N4 |
| Molecular Weight | 396.54 g/mol |
| Exact Mass | 396.23 |
| IUPAC Name | 3-[1-(2,2-dimethylpent-4-enylamino)-2,2-dipyridin-3-ylethyl]benzonitrile |
| SMILES | C=CCC(C)(C)CNC(c1cccc(C#N)c1)C(c1cccnc1)c1cccnc1 |
| InChI | InChI=1S/C26H28N4/c1-4-12-26(2,3)19-30-25(21-9-5-8-20(15-21)16-27)24(22-10-6-13-28-17-22)23-11-7-14-29-18-23/h4-11,13-15,17-18,24-25,30H,1,12,19H2,2-3H3 |
| InChIKey | XCHLDNSWXRAVPD-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.54 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|