C23H22N4O — CID 57425770
3-(1-morpholin-4-yl-2,2-dipyridin-3-ylethyl)benzonitrile (PubChem CID 57425770) has the molecular formula C23H22N4O and a molecular weight of 370.46 g/mol. Its IUPAC name is 3-(1-morpholin-4-yl-2,2-dipyridin-3-ylethyl)benzonitrile.
| Compound Name | 3-(1-morpholin-4-yl-2,2-dipyridin-3-ylethyl)benzonitrile |
|---|---|
| PubChem CID | 57425770 |
| Molecular Formula | C23H22N4O |
| Molecular Weight | 370.46 g/mol |
| Exact Mass | 370.18 |
| IUPAC Name | 3-(1-morpholin-4-yl-2,2-dipyridin-3-ylethyl)benzonitrile |
| SMILES | N#Cc1cccc(C(C(c2cccnc2)c2cccnc2)N2CCOCC2)c1 |
| InChI | InChI=1S/C23H22N4O/c24-15-18-4-1-5-19(14-18)23(27-10-12-28-13-11-27)22(20-6-2-8-25-16-20)21-7-3-9-26-17-21/h1-9,14,16-17,22-23H,10-13H2 |
| InChIKey | JUVPEGCPICRZHE-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 62.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.46 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |