C22H22ClN3O — CID 66962797
4-[1-(3-chlorophenyl)-2,2-dipyridin-3-ylethyl]morpholine (PubChem CID 66962797) has the molecular formula C22H22ClN3O and a molecular weight of 379.89 g/mol. Its IUPAC name is 4-[1-(3-chlorophenyl)-2,2-dipyridin-3-ylethyl]morpholine.
| Compound Name | 4-[1-(3-chlorophenyl)-2,2-dipyridin-3-ylethyl]morpholine |
|---|---|
| PubChem CID | 66962797 |
| Molecular Formula | C22H22ClN3O |
| Molecular Weight | 379.89 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | 4-[1-(3-chlorophenyl)-2,2-dipyridin-3-ylethyl]morpholine |
| SMILES | Clc1cccc(C(C(c2cccnc2)c2cccnc2)N2CCOCC2)c1 |
| InChI | InChI=1S/C22H22ClN3O/c23-20-7-1-4-17(14-20)22(26-10-12-27-13-11-26)21(18-5-2-8-24-15-18)19-6-3-9-25-16-19/h1-9,14-16,21-22H,10-13H2 |
| InChIKey | XUOMPHBFMZWGCV-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.89 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |