C22H21Cl2N3O — CID 69009942
4-[1-(2,3-dichlorophenyl)-2,2-dipyridin-3-ylethyl]morpholine (PubChem CID 69009942) has the molecular formula C22H21Cl2N3O and a molecular weight of 414.34 g/mol. Its IUPAC name is 4-[1-(2,3-dichlorophenyl)-2,2-dipyridin-3-ylethyl]morpholine.
| Compound Name | 4-[1-(2,3-dichlorophenyl)-2,2-dipyridin-3-ylethyl]morpholine |
|---|---|
| PubChem CID | 69009942 |
| Molecular Formula | C22H21Cl2N3O |
| Molecular Weight | 414.34 g/mol |
| Exact Mass | 413.11 |
| IUPAC Name | 4-[1-(2,3-dichlorophenyl)-2,2-dipyridin-3-ylethyl]morpholine |
| SMILES | Clc1cccc(C(C(c2cccnc2)c2cccnc2)N2CCOCC2)c1Cl |
| InChI | InChI=1S/C22H21Cl2N3O/c23-19-7-1-6-18(21(19)24)22(27-10-12-28-13-11-27)20(16-4-2-8-25-14-16)17-5-3-9-26-15-17/h1-9,14-15,20,22H,10-13H2 |
| InChIKey | CLZZXPXAFKDINL-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.34 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |