C21H17N5 — CID 59706219
3-[1-(cyanomethylamino)-2,2-dipyridin-3-ylethyl]benzonitrile (PubChem CID 59706219) has the molecular formula C21H17N5 and a molecular weight of 339.40 g/mol. Its IUPAC name is 3-[1-(cyanomethylamino)-2,2-dipyridin-3-ylethyl]benzonitrile.
| Compound Name | 3-[1-(cyanomethylamino)-2,2-dipyridin-3-ylethyl]benzonitrile |
|---|---|
| PubChem CID | 59706219 |
| Molecular Formula | C21H17N5 |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | 3-[1-(cyanomethylamino)-2,2-dipyridin-3-ylethyl]benzonitrile |
| SMILES | N#CCNC(c1cccc(C#N)c1)C(c1cccnc1)c1cccnc1 |
| InChI | InChI=1S/C21H17N5/c22-8-11-26-21(17-5-1-4-16(12-17)13-23)20(18-6-2-9-24-14-18)19-7-3-10-25-15-19/h1-7,9-10,12,14-15,20-21,26H,11H2 |
| InChIKey | OAWQEXKNOPQGGJ-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 85.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|